Compound Q&A

Are there alternatives to D-Guluronic acid (CAS: 15769-56-9) in synthesis?

Answer

D-Guluronic acid
In synthesis, there are several alternatives to D-Guluronic acid (CAS: 15769-56-9), such as D-Galacturonic acid and D-Mannuronic acid, which are structural analogs. Other substitutes include chemical precursors like 2-keto-3-deoxy-d-gluconic acid. These alternatives can be used depending on the specific requirements of the synthesis process, offering flexibility in chemical reactivity and properties.

About

CAS No 15769-56-9
English Name D-Guluronic acid
Molecular Formula C6H10O7
Molecular Weight 194.14 g/mol
SMILES C(=O)C(C(C(C(C(=O)O)O)O)O)O
InChIKey IAJILQKETJEXLJ-KLVWXMOXSA-N
Last Updated: 2026-03-03 11:03

Related Q&A

Compound Q&A

What regulatory guidelines apply to D-Guluronic acid (CAS: 15769-56-9)?

D-Guluronic acid (CAS: 15769-56-9) is subject to various regulatory guidelines. In the European Unio...

Compound Q&A

What is the market or research trend for D-Guluronic acid (CAS: 15769-56-9)?

The market for D-Guluronic acid (CAS: 15769-56-9) is growing due to its increasing use in biomedical...

Compound Q&A

How should waste containing D-Guluronic acid (CAS: 15769-56-9) be handled?

Waste containing D-Guluronic acid (CAS: 15769-56-9) should be handled carefully to prevent environme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...