Compound Q&A

What is the market or research trend for (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7)?

Answer

2-Methyl-2-propanyl (2S,5R)-5-amino-2-methyl-1-piperidinecarboxylate
The market and research trends for (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) are driven by its applications in drug discovery and pharmaceuticals. As research progresses, there is an increasing focus on developing more efficient synthesis methods and exploring its potential in medicinal chemistry. Additionally, with growing environmental and safety concerns, there is a trend towards using less toxic and more sustainable alternatives. The compound's unique structure and functional groups make it a valuable reagent in developing new drug candidates and improving existing pharmaceuticals.

About

English Name 2-Methyl-2-propanyl (2S,5R)-5-amino-2-methyl-1-piperidinecarboxylate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES C[C@H]1CC[C@H](CN1C(=O)OC(C)(C)C)N
InChIKey ZKBBQGSSDAJNKG-DTWKUNHWSA-N
Last Updated: 2026-03-03 11:03

Related Q&A

Compound Q&A

What regulatory guidelines apply to (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7)?

The compound (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) is subjec...

Compound Q&A

Are there alternatives to (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) in synthesis?

While (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) is a specific co...

Compound Q&A

How should waste containing (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) be handled?

Waste containing (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...