Compound Q&A

Are there alternatives to (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) in synthesis?

Answer

2-Methyl-2-propanyl (2S,5R)-5-amino-2-methyl-1-piperidinecarboxylate
While (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) is a specific compound, there are alternative reagents and analogs that can be used in synthesis depending on the desired properties. Common alternatives include other piperidine derivatives with similar functional groups, such as 2-methylpiperidine or 2-amino-2-methylpropionic acid, which can serve similar roles in organic synthesis and provide similar chemical functionalities. Researchers often explore these alternatives to optimize reaction conditions and improve product yields.

About

English Name 2-Methyl-2-propanyl (2S,5R)-5-amino-2-methyl-1-piperidinecarboxylate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES C[C@H]1CC[C@H](CN1C(=O)OC(C)(C)C)N
InChIKey ZKBBQGSSDAJNKG-DTWKUNHWSA-N
Last Updated: 2026-03-03 11:03

Related Q&A

Compound Q&A

What regulatory guidelines apply to (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7)?

The compound (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) is subjec...

Compound Q&A

What is the market or research trend for (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7)?

The market and research trends for (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1...

Compound Q&A

How should waste containing (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) be handled?

Waste containing (2S,5R)-5-amino-2-methyl-2-propanyl piperidinecarboxylate (CAS: 1792190-72-7) shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...