Compound Q&A

What precautions should be taken when handling cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4)?

Answer

cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate
When handling cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4), it is essential to use personal protective equipment (PPE) including gloves, goggles, and a laboratory coat. Work should be conducted in a fume hood to minimize inhalation risks. Spills should be cleaned up carefully, and appropriate safety data sheets (SDS) should be consulted for detailed instructions. Ensure proper ventilation and storage in a secure, dry location away from oxidizing agents.

About

English Name cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate
Molecular Formula C11H8CuF3N2S++
Molecular Weight 320.81 g/mol
SMILES FC(F)(F)S[Cu].c1ccc(nc1)c2ccccn2
InChIKey TWUWEXFRMUWRRW-UHFFFAOYSA-M
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4)?

Cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4) is a crystalline compound...

Compound Q&A

How is cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4) typically synthesized?

Cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate is typically synthesized by the reaction of c...

Compound Q&A

What industries use cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4)?

Cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4) is used in the pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...