Compound Q&A

What are the physical and chemical properties of cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4)?

Answer

cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate
Cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4) is a crystalline compound with a molecular weight of approximately 466.84 g/mol. It is poorly soluble in water but soluble in organic solvents. Chemically, it is reactive towards oxidizing agents and exhibits coordination chemistry typical of cuprous compounds. It forms stable complexes and is known for its catalytic activity in various reactions.

About

English Name cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate
Molecular Formula C11H8CuF3N2S++
Molecular Weight 320.81 g/mol
SMILES FC(F)(F)S[Cu].c1ccc(nc1)c2ccccn2
InChIKey TWUWEXFRMUWRRW-UHFFFAOYSA-M
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

How is cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4) typically synthesized?

Cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate is typically synthesized by the reaction of c...

Compound Q&A

What industries use cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4)?

Cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4) is used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4)?

When handling cuprous;2-(2-pyridyl)pyridine;trifluoromethanethiolate (CAS: 1413732-47-4), it is esse...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...