Compound Q&A

What are the physical and chemical properties of Ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate (CAS: 56649-47-9)?

Answer

Ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate
Ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate is a white crystalline solid with a molecular weight of approximately 282.34 g/mol. It has a high solubility in organic solvents like ethanol and acetone but is poorly soluble in water. The compound is moderately reactive, showing good stability under acidic conditions and moderate reactivity in basic environments. It is also known to have some reactivity towards nucleophiles.

About

CAS No 56649-47-9
English Name Ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate
Molecular Formula C14H16N2O2
Molecular Weight 244.29 g/mol
SMILES CCOC(=O)C1=CN=CN1C(C)C2=CC=CC=C2
InChIKey NPUKDXXFDDZOKR-UHFFFAOYSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

How is Ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate (CAS: 56649-47-9) typically synthesized?

Ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate is typically synthesized through a multi-step pro...

Compound Q&A

What industries use Ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate (CAS: 56649-47-9)?

Ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate is used in various industries, including pharmace...

Compound Q&A

What precautions should be taken when handling Ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate (CAS: 56649-47-9)?

Proper handling of Ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate requires the use of appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...