Compound Q&A

What industries use 4-({4-[(E)-(2-Methyl-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)diazenyl]phenyl}amino)-3-nitrobenzenesulfonic acid (CAS: 12220-06-3)?

Answer

4-({4-[(E)-(2-Methyl-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)diazenyl]phenyl}amino)-3-nitrobenzenesulfonic acid
This compound is primarily used in the pharmaceutical industry for the development of certain drug candidates. It has potential applications in the sensor industry due to its reactivity and stability under specific conditions. In the semiconductor industry, it can be used as a dopant or in the fabrication of certain materials.

About

CAS No 12220-06-3
English Name 4-({4-[(E)-(2-Methyl-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)diazenyl]phenyl}amino)-3-nitrobenzenesulfonic acid
Molecular Formula C26H22N4O8S2
Molecular Weight 582.6 g/mol
EINECS 235-406-9
SMILES Cc1ccc(cc1)S(=O)(=O)Oc2ccc(c(c2)C)/N=N/c3ccc(cc3)Nc4ccc(cc4[N+](=O)[O-])S(=O)(=O)O
InChIKey KGSAVDJVMKFBJP-ZQHSETAFSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

How is 4-({4-[(E)-(2-Methyl-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)diazenyl]phenyl}amino)-3-nitrobenzenesulfonic acid (CAS: 12220-06-3) typically synthesized?

This compound is usually prepared through a multi-step synthesis involving diazotization, diazotrans...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...