Compound Q&A

What are the physical and chemical properties of 4-({4-[(E)-(2-Methyl-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)diazenyl]phenyl}amino)-3-nitrobenzenesulfonic acid (CAS: 12220-06-3)?

Answer

4-({4-[(E)-(2-Methyl-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)diazenyl]phenyl}amino)-3-nitrobenzenesulfonic acid
This compound is a crystalline solid with a molecular weight of approximately 614.7 g/mol. It is moderately soluble in water and organic solvents. The compound is highly reactive due to the presence of the diazenyl and nitro groups. It is also sensitive to light and air exposure, making it prone to degradation.

About

CAS No 12220-06-3
English Name 4-({4-[(E)-(2-Methyl-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)diazenyl]phenyl}amino)-3-nitrobenzenesulfonic acid
Molecular Formula C26H22N4O8S2
Molecular Weight 582.6 g/mol
EINECS 235-406-9
SMILES Cc1ccc(cc1)S(=O)(=O)Oc2ccc(c(c2)C)/N=N/c3ccc(cc3)Nc4ccc(cc4[N+](=O)[O-])S(=O)(=O)O
InChIKey KGSAVDJVMKFBJP-ZQHSETAFSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

How is 4-({4-[(E)-(2-Methyl-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)diazenyl]phenyl}amino)-3-nitrobenzenesulfonic acid (CAS: 12220-06-3) typically synthesized?

This compound is usually prepared through a multi-step synthesis involving diazotization, diazotrans...

Compound Q&A

What industries use 4-({4-[(E)-(2-Methyl-4-{[(4-methylphenyl)sulfonyl]oxy}phenyl)diazenyl]phenyl}amino)-3-nitrobenzenesulfonic acid (CAS: 12220-06-3)?

This compound is primarily used in the pharmaceutical industry for the development of certain drug c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...