Compound Q&A

What industries use 17-phenyl-trinor-PGF2alpha amide (CAS: 155205-89-3)?

Answer

17-phenyl-trinor-PGF2alpha amide
17-phenyl-trinor-PGF2alpha amide is mainly used in the pharmaceutical industry for its potential as a precursor in the synthesis of bioactive compounds. It can also find applications in the polymer industry for its potential use in the development of advanced materials, although its specific applications in this field are limited.

About

English Name 17-phenyl-trinor-PGF2alpha amide
Molecular Formula C23H33NO4
Molecular Weight 387.52 g/mol
SMILES C1C(C(C(C1O)C=CC(CCC2=CC=CC=C2)O)CC=CCCCC(=O)N)O
InChIKey RAGQWYIPCPFTJC-KDACTHKWSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 17-phenyl-trinor-PGF2alpha amide (CAS: 155205-89-3)?

17-phenyl-trinor-PGF2alpha amide is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is 17-phenyl-trinor-PGF2alpha amide (CAS: 155205-89-3) typically synthesized?

17-phenyl-trinor-PGF2alpha amide is synthesized through a series of reactions including a Wittig rea...

Compound Q&A

What precautions should be taken when handling 17-phenyl-trinor-PGF2alpha amide (CAS: 155205-89-3)?

When handling 17-phenyl-trinor-PGF2alpha amide, appropriate personal protective equipment (PPE) shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...