Compound Q&A

How is 17-phenyl-trinor-PGF2alpha amide (CAS: 155205-89-3) typically synthesized?

Answer

17-phenyl-trinor-PGF2alpha amide
17-phenyl-trinor-PGF2alpha amide is synthesized through a series of reactions including a Wittig reaction, followed by an amide formation step. The key reaction involves the Wittig reagent derived from 17-phenyl-trinor-PGF2alpha. The synthesis typically requires mild conditions and the use of a Lewis acid catalyst. The overall yield can range from 60-70%, with high selectivity for the desired amide product.

About

English Name 17-phenyl-trinor-PGF2alpha amide
Molecular Formula C23H33NO4
Molecular Weight 387.52 g/mol
SMILES C1C(C(C(C1O)C=CC(CCC2=CC=CC=C2)O)CC=CCCCC(=O)N)O
InChIKey RAGQWYIPCPFTJC-KDACTHKWSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 17-phenyl-trinor-PGF2alpha amide (CAS: 155205-89-3)?

17-phenyl-trinor-PGF2alpha amide is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

What industries use 17-phenyl-trinor-PGF2alpha amide (CAS: 155205-89-3)?

17-phenyl-trinor-PGF2alpha amide is mainly used in the pharmaceutical industry for its potential as ...

Compound Q&A

What precautions should be taken when handling 17-phenyl-trinor-PGF2alpha amide (CAS: 155205-89-3)?

When handling 17-phenyl-trinor-PGF2alpha amide, appropriate personal protective equipment (PPE) shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...