Compound Q&A

How is Amoxicillin EP Impurity C (CAS: 2088961-37-7) typically synthesized?

Answer

Amoxicillin EP Impurity C (Amoxicillin Diketopiperazines)
Amoxicillin EP Impurity C is typically synthesized as a byproduct of the synthesis of amoxicillin. The diketopiperazines are formed through the condensation of amoxicillin with itself or other amino acids, leading to a mixture of impurities, including Amoxicillin EP Impurity C.

About

English Name Amoxicillin EP Impurity C (Amoxicillin Diketopiperazines)
Molecular Formula C16H19N3O5S
Molecular Weight 365.4 g/mol
SMILES S1C(C2C(NC(C3C=CC(=CC=3)O)C(N2)=O)=O)N[C@@H](C(=O)O)C1(C)C
InChIKey IIZCCQJEPBWGJU-DGVZPSOQSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amoxicillin EP Impurity C (CAS: 2088961-37-7)?

Amoxicillin EP Impurity C, also known as Amoxicillin Diketopiperazines, is a crystalline compound wi...

Compound Q&A

What industries use Amoxicillin EP Impurity C (CAS: 2088961-37-7)?

Amoxicillin EP Impurity C is primarily used in the pharmaceutical industry for quality control and i...

Compound Q&A

What precautions should be taken when handling Amoxicillin EP Impurity C (CAS: 2088961-37-7)?

When handling Amoxicillin EP Impurity C, standard laboratory safety precautions should be followed. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...