Compound Q&A

How is (2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (CAS: 10003-64-2) typically synthesized?

Answer

(2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (non-preferred name)
The compound is synthesized via a multi-step process involving condensation reactions, ring opening, and esterification. Commonly, hydroxy acids and amines are used as precursors with the use of catalytic amounts of acid or base. The yield is typically around 75-85% with good selectivity.

About

CAS No 10003-64-2
English Name (2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (non-preferred name)
Molecular Formula C11H21NO7
Molecular Weight 279.29 g/mol
SMILES CC(C)C(C(=O)O)NCC(=O)C(C(C(CO)O)O)O
InChIKey JEQHVKBNRPNQDY-UTINFBMNSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (CAS: 10003-64-2)?

The compound is a white or off-white solid with a crystalline form. Its molecular weight is approxim...

Compound Q&A

What industries use (2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (CAS: 10003-64-2)?

This compound is used in pharmaceuticals for its bioactive properties, in polymers for its functiona...

Compound Q&A

What precautions should be taken when handling (2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (CAS: 10003-64-2)?

Handle in a well-ventilated area or fume hood. Use appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...