Compound Q&A

What are the physical and chemical properties of (2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (CAS: 10003-64-2)?

Answer

(2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (non-preferred name)
The compound is a white or off-white solid with a crystalline form. Its molecular weight is approximately 326.32 g/mol. It is slightly soluble in water and has a characteristic pKa around 6.8. Reactivity is moderate, typically requiring mild conditions for chemical transformations.

About

CAS No 10003-64-2
English Name (2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (non-preferred name)
Molecular Formula C11H21NO7
Molecular Weight 279.29 g/mol
SMILES CC(C)C(C(=O)O)NCC(=O)C(C(C(CO)O)O)O
InChIKey JEQHVKBNRPNQDY-UTINFBMNSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

How is (2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (CAS: 10003-64-2) typically synthesized?

The compound is synthesized via a multi-step process involving condensation reactions, ring opening,...

Compound Q&A

What industries use (2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (CAS: 10003-64-2)?

This compound is used in pharmaceuticals for its bioactive properties, in polymers for its functiona...

Compound Q&A

What precautions should be taken when handling (2S)-3-Methyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}butanoic acid (CAS: 10003-64-2)?

Handle in a well-ventilated area or fume hood. Use appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...