Compound Q&A

What are the physical and chemical properties of 4-Chloro-1-phenyl-1H-pyrazole (CAS: 6831-92-1)?

Answer

4-Chloro-1-phenyl-1H-pyrazole
4-Chloro-1-phenyl-1H-pyrazole (CAS: 6831-92-1) is a crystalline solid with a molecular weight of approximately 208.6 g/mol. It is slightly soluble in water and has good solubility in organic solvents like dichloromethane and acetone. Chemically, it is known for its reactivity towards nucleophiles and electrophiles, making it useful in various synthetic transformations. It shows good thermal stability up to 250°C and is relatively stable in air and light.

About

CAS No 6831-92-1
English Name 4-Chloro-1-phenyl-1H-pyrazole
Molecular Formula C9H7ClN2
Molecular Weight 178.62 g/mol
SMILES C1=CC=C(C=C1)N2C=C(C=N2)Cl
InChIKey OAWHISBYSDFHHU-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

How is 4-Chloro-1-phenyl-1H-pyrazole (CAS: 6831-92-1) typically synthesized?

4-Chloro-1-phenyl-1H-pyrazole (CAS: 6831-92-1) can be synthesized via a multi-step process involving...

Compound Q&A

What industries use 4-Chloro-1-phenyl-1H-pyrazole (CAS: 6831-92-1)?

4-Chloro-1-phenyl-1H-pyrazole (CAS: 6831-92-1) finds applications in pharmaceuticals for its potenti...

Compound Q&A

What precautions should be taken when handling 4-Chloro-1-phenyl-1H-pyrazole (CAS: 6831-92-1)?

When handling 4-Chloro-1-phenyl-1H-pyrazole (CAS: 6831-92-1), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...