Compound Q&A

What precautions should be taken when handling 6-Bromo-8-fluoro-2-quinazolinol (CAS: 1036756-15-6)?

Answer

6-Bromo-8-fluoro-2-quinazolinol
Proper handling of 6-Bromo-8-fluoro-2-quinazolinol requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a well-ventilated area or a fume hood to avoid inhalation. Spills should be cleaned up using absorbent materials followed by thorough rinsing. This compound is not considered hazardous, but proper safety data sheets (SDS) should be consulted for detailed handling instructions and emergency procedures.

About

English Name 6-Bromo-8-fluoro-2-quinazolinol
Molecular Formula C8H4BrFN2O
Molecular Weight 243.035 g/mol
SMILES Brc1cc(F)c2c(c1)cnc(=O)[nH]2
InChIKey OTRNZYHGHUEGKS-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-8-fluoro-2-quinazolinol (CAS: 1036756-15-6)?

6-Bromo-8-fluoro-2-quinazolinol is a white crystalline solid with a molecular weight of 241.04 g/mol...

Compound Q&A

How is 6-Bromo-8-fluoro-2-quinazolinol (CAS: 1036756-15-6) typically synthesized?

6-Bromo-8-fluoro-2-quinazolinol is typically synthesized through a multi-step process starting from ...

Compound Q&A

What industries use 6-Bromo-8-fluoro-2-quinazolinol (CAS: 1036756-15-6)?

6-Bromo-8-fluoro-2-quinazolinol is primarily used in the pharmaceutical industry for the development...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...