Compound Q&A

What are the physical and chemical properties of 6-Bromo-8-fluoro-2-quinazolinol (CAS: 1036756-15-6)?

Answer

6-Bromo-8-fluoro-2-quinazolinol
6-Bromo-8-fluoro-2-quinazolinol is a white crystalline solid with a molecular weight of 241.04 g/mol. It has a melting point of 255-258°C and is slightly soluble in water. This compound exhibits good solubility in organic solvents like chloroform and acetonitrile. Chemically, it is stable under normal conditions but can react with strong nucleophiles. It is used in the synthesis of pharmaceuticals and other organic compounds.

About

English Name 6-Bromo-8-fluoro-2-quinazolinol
Molecular Formula C8H4BrFN2O
Molecular Weight 243.035 g/mol
SMILES Brc1cc(F)c2c(c1)cnc(=O)[nH]2
InChIKey OTRNZYHGHUEGKS-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

How is 6-Bromo-8-fluoro-2-quinazolinol (CAS: 1036756-15-6) typically synthesized?

6-Bromo-8-fluoro-2-quinazolinol is typically synthesized through a multi-step process starting from ...

Compound Q&A

What industries use 6-Bromo-8-fluoro-2-quinazolinol (CAS: 1036756-15-6)?

6-Bromo-8-fluoro-2-quinazolinol is primarily used in the pharmaceutical industry for the development...

Compound Q&A

What precautions should be taken when handling 6-Bromo-8-fluoro-2-quinazolinol (CAS: 1036756-15-6)?

Proper handling of 6-Bromo-8-fluoro-2-quinazolinol requires the use of personal protective equipment...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...