Compound Q&A

What industries use 2-Bromo-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 886367-52-8)?

Answer

2-Bromo-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole
2-Bromo-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole finds applications in the pharmaceutical industry for the synthesis of various medicinal compounds. It is also used in the development of sensors and semiconductors, particularly in the fabrication of organic light-emitting diodes (OLEDs) and other electronic devices due to its specific chemical properties.

About

English Name 2-Bromo-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole
Molecular Formula C10H5BrF3NS
Molecular Weight 308.122 g/mol
SMILES C1=CC(=CC=C1C2=CSC(=N2)Br)C(F)(F)F
InChIKey NQYLAXLAADNHAO-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 886367-52-8)?

2-Bromo-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole is a crystalline solid with a molecular weight of...

Compound Q&A

How is 2-Bromo-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 886367-52-8) typically synthesized?

2-Bromo-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole is typically synthesized via a nucleophilic subst...

Compound Q&A

What precautions should be taken when handling 2-Bromo-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 886367-52-8)?

When handling 2-Bromo-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole, it is essential to use personal pr...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...