Compound Q&A

What industries use Folic Acid-13C5 (CAS: 1207282-75-4)?

Answer

Folic Acid-13C5
Folic Acid-13C5 (CAS: 1207282-75-4) is primarily used in pharmaceutical research, particularly in metabolic studies and drug development. It is also relevant in food science for nutritional assessments and in analytical chemistry for isotopic analysis and labeling.

About

English Name Folic Acid-13C5
Molecular Formula C19H19N7O6
Molecular Weight 446.37 g/mol
SMILES C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N
InChIKey OVBPIULPVIDEAO-BCTWCYHZSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of Folic Acid-13C5 (CAS: 1207282-75-4)?

Folic Acid-13C5 (CAS: 1207282-75-4) is a form of folic acid labeled with five carbon-13 isotopes. It...

Compound Q&A

How is Folic Acid-13C5 (CAS: 1207282-75-4) typically synthesized?

Folic Acid-13C5 (CAS: 1207282-75-4) is synthesized by labeling folic acid with carbon-13 isotopes. C...

Compound Q&A

What precautions should be taken when handling Folic Acid-13C5 (CAS: 1207282-75-4)?

When handling Folic Acid-13C5 (CAS: 1207282-75-4), it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...