Compound Q&A

What are the physical and chemical properties of Folic Acid-13C5 (CAS: 1207282-75-4)?

Answer

Folic Acid-13C5
Folic Acid-13C5 (CAS: 1207282-75-4) is a form of folic acid labeled with five carbon-13 isotopes. It has a molecular weight of approximately 681.8 g/mol. This compound is highly water-soluble and exhibits moderate reactivity typical of folic acid derivatives. Its crystalline form is stable under normal storage conditions, but it should be protected from moisture and light to maintain its integrity.

About

English Name Folic Acid-13C5
Molecular Formula C19H19N7O6
Molecular Weight 446.37 g/mol
SMILES C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N
InChIKey OVBPIULPVIDEAO-BCTWCYHZSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

How is Folic Acid-13C5 (CAS: 1207282-75-4) typically synthesized?

Folic Acid-13C5 (CAS: 1207282-75-4) is synthesized by labeling folic acid with carbon-13 isotopes. C...

Compound Q&A

What industries use Folic Acid-13C5 (CAS: 1207282-75-4)?

Folic Acid-13C5 (CAS: 1207282-75-4) is primarily used in pharmaceutical research, particularly in me...

Compound Q&A

What precautions should be taken when handling Folic Acid-13C5 (CAS: 1207282-75-4)?

When handling Folic Acid-13C5 (CAS: 1207282-75-4), it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...