Compound Q&A

What are the physical and chemical properties of (5alpha,5'alpha)-2-Bromo-12'-hydroxy-5'-isobutyl-2'-isopropyl-3',6',18-trioxoergotaman (CAS: 65700-36-9)?

Answer

(5alpha,5'alpha)-2-Bromo-12'-hydroxy-5'-isobutyl-2'-isopropyl-3',6',18-trioxoergotaman
The compound (5alpha,5'alpha)-2-Bromo-12'-hydroxy-5'-isobutyl-2'-isopropyl-3',6',18-trioxoergotaman has a crystalline form with a molecular weight of approximately 789.84 g/mol. It is slightly soluble in organic solvents like dichloromethane and ethanol. The compound is reactive, particularly towards nucleophiles and reducing agents. It is not flammable but should be handled with care due to its reactivity.

About

CAS No 65700-36-9
English Name (5alpha,5'alpha)-2-Bromo-12'-hydroxy-5'-isobutyl-2'-isopropyl-3',6',18-trioxoergotaman
Molecular Formula C32H40BrN5O5
Molecular Weight 654.61 g/mol
SMILES CC(C)C[C@H]1C(=O)N2CCC[C@H]2[C@]3(N1C(=O)[C@](O3)(C(C)C)NC(=O)[C@@H]4CN([C@@H]5Cc6c7c(cccc7[nH]c6Br)C5=C4)C)O
InChIKey OZVBMTJYIDMWIL-SHUSXKRSSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

How is (5alpha,5'alpha)-2-Bromo-12'-hydroxy-5'-isobutyl-2'-isopropyl-3',6',18-trioxoergotaman (CAS: 65700-36-9) typically synthesized?

The compound is typically synthesized through a multistep process involving bromination of a precurs...

Compound Q&A

What industries use (5alpha,5'alpha)-2-Bromo-12'-hydroxy-5'-isobutyl-2'-isopropyl-3',6',18-trioxoergotaman (CAS: 65700-36-9)?

This compound is used in pharmaceutical applications, particularly in the development of novel thera...

Compound Q&A

What precautions should be taken when handling (5alpha,5'alpha)-2-Bromo-12'-hydroxy-5'-isobutyl-2'-isopropyl-3',6',18-trioxoergotaman (CAS: 65700-36-9)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...