Compound Q&A

What industries use 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside (CAS: 63503-05-9)?

Answer

2-Naphthyl 6-deoxy-alpha-L-galactopyranoside
2-Naphthyl 6-deoxy-alpha-L-galactopyranoside finds applications in pharmaceuticals, where it serves as a building block for complex sugar structures. It is also used in the synthesis of certain polymers and sensors due to its functional groups. Additionally, it is employed in the development of new materials for semiconductors.

About

CAS No 63503-05-9
English Name 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside
Molecular Formula C16H18O5
Molecular Weight 290.32 g/mol
SMILES O[C@@H]([C@@H]([C@@H]([C@H](C)O1)O)O)[C@@H]1OC2=CC=C3C=CC=CC3=C2
InChIKey HFJUQSUBZOKELZ-FITDYDNJSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside (CAS: 63503-05-9)?

2-Naphthyl 6-deoxy-alpha-L-galactopyranoside is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside (CAS: 63503-05-9) typically synthesized?

2-Naphthyl 6-deoxy-alpha-L-galactopyranoside is commonly synthesized through the condensation of 2-n...

Compound Q&A

What precautions should be taken when handling 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside (CAS: 63503-05-9)?

Proper handling of 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside requires the use of personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...