Compound Q&A

What are the physical and chemical properties of 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside (CAS: 63503-05-9)?

Answer

2-Naphthyl 6-deoxy-alpha-L-galactopyranoside
2-Naphthyl 6-deoxy-alpha-L-galactopyranoside is a crystalline solid with a molecular weight of approximately 237.24 g/mol. It is sparingly soluble in water and ethanol, and slightly soluble in methanol. This compound exhibits moderate reactivity, particularly in nucleophilic substitution reactions, making it useful in various synthetic applications.

About

CAS No 63503-05-9
English Name 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside
Molecular Formula C16H18O5
Molecular Weight 290.32 g/mol
SMILES O[C@@H]([C@@H]([C@@H]([C@H](C)O1)O)O)[C@@H]1OC2=CC=C3C=CC=CC3=C2
InChIKey HFJUQSUBZOKELZ-FITDYDNJSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

How is 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside (CAS: 63503-05-9) typically synthesized?

2-Naphthyl 6-deoxy-alpha-L-galactopyranoside is commonly synthesized through the condensation of 2-n...

Compound Q&A

What industries use 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside (CAS: 63503-05-9)?

2-Naphthyl 6-deoxy-alpha-L-galactopyranoside finds applications in pharmaceuticals, where it serves ...

Compound Q&A

What precautions should be taken when handling 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside (CAS: 63503-05-9)?

Proper handling of 2-Naphthyl 6-deoxy-alpha-L-galactopyranoside requires the use of personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...