Compound Q&A

How is 5-Methoxy-1,3-benzothiazole-2-carbonitrile (CAS: 7267-35-8) typically synthesized?

Answer

5-Methoxy-1,3-benzothiazole-2-carbonitrile
5-Methoxy-1,3-benzothiazole-2-carbonitrile can be synthesized through the reaction of 1,3-benzothiazole with methanol in the presence of sodium methoxide as a base. The reaction is carried out in an aprotic solvent like dimethylformamide (DMF) at a temperature around 100°C. The process involves the methylation of the thiazole ring followed by the introduction of a nitrile group. The yield of the product is typically around 85-90%, with good selectivity and purity.

About

CAS No 7267-35-8
English Name 5-Methoxy-1,3-benzothiazole-2-carbonitrile
Molecular Formula C9H6N2OS
Molecular Weight 17.03 g/mol
SMILES COC1=CC2=C(C=C1)SC(=N2)C#N
InChIKey VGMJEBGREMDOBT-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methoxy-1,3-benzothiazole-2-carbonitrile (CAS: 7267-35-8)?

5-Methoxy-1,3-benzothiazole-2-carbonitrile is a white crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 5-Methoxy-1,3-benzothiazole-2-carbonitrile (CAS: 7267-35-8)?

5-Methoxy-1,3-benzothiazole-2-carbonitrile is primarily used in the pharmaceutical industry due to i...

Compound Q&A

What precautions should be taken when handling 5-Methoxy-1,3-benzothiazole-2-carbonitrile (CAS: 7267-35-8)?

When handling 5-Methoxy-1,3-benzothiazole-2-carbonitrile, it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...