Compound Q&A

What are the physical and chemical properties of 5-Methoxy-1,3-benzothiazole-2-carbonitrile (CAS: 7267-35-8)?

Answer

5-Methoxy-1,3-benzothiazole-2-carbonitrile
5-Methoxy-1,3-benzothiazole-2-carbonitrile is a white crystalline solid with a molecular weight of approximately 227.23 g/mol. It is slightly soluble in water but highly soluble in organic solvents like methanol and ethanol. The compound is known for its moderate reactivity towards nucleophiles and electrophiles, making it useful in various synthetic transformations. It has a melting point around 225-227°C and is stable under normal conditions, but care should be taken to avoid prolonged exposure to heat and light.

About

CAS No 7267-35-8
English Name 5-Methoxy-1,3-benzothiazole-2-carbonitrile
Molecular Formula C9H6N2OS
Molecular Weight 17.03 g/mol
SMILES COC1=CC2=C(C=C1)SC(=N2)C#N
InChIKey VGMJEBGREMDOBT-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

How is 5-Methoxy-1,3-benzothiazole-2-carbonitrile (CAS: 7267-35-8) typically synthesized?

5-Methoxy-1,3-benzothiazole-2-carbonitrile can be synthesized through the reaction of 1,3-benzothiaz...

Compound Q&A

What industries use 5-Methoxy-1,3-benzothiazole-2-carbonitrile (CAS: 7267-35-8)?

5-Methoxy-1,3-benzothiazole-2-carbonitrile is primarily used in the pharmaceutical industry due to i...

Compound Q&A

What precautions should be taken when handling 5-Methoxy-1,3-benzothiazole-2-carbonitrile (CAS: 7267-35-8)?

When handling 5-Methoxy-1,3-benzothiazole-2-carbonitrile, it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...