Compound Q&A

What precautions should be taken when handling delta23-FK-506 (CAS: 104987-16-8)?

Answer

delta23-FK-506
When handling delta23-FK-506, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize inhalation risks. Spills should be cleaned up immediately using personal protective equipment and following standard safety protocols. For detailed safety information, refer to the Material Safety Data Sheet (MSDS/SDS).

About

English Name delta23-FK-506
Molecular Formula C44H67NO11
Molecular Weight 786.02 g/mol
SMILES CC1CC(C2C(CC(C(O2)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C=CC(=O)C(C=C(C1)C)CC=C)C)C(=CC4CCC(C(C4)OC)O)C)O)C)OC)OC
InChIKey PLHJNIVKYISEQW-ADGUVUBISA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of delta23-FK-506 (CAS: 104987-16-8)?

Delta23-FK-506 is a crystalline compound with a molecular weight of approximately 661.72 g/mol. It i...

Compound Q&A

How is delta23-FK-506 (CAS: 104987-16-8) typically synthesized?

Delta23-FK-506 is typically synthesized through a multi-step process involving protection of functio...

Compound Q&A

What industries use delta23-FK-506 (CAS: 104987-16-8)?

Delta23-FK-506 is primarily used in the pharmaceutical industry for research purposes, particularly ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...