Compound Q&A

How is 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid (CAS: 22871-58-5) typically synthesized?

Answer

3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid
3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid is typically synthesized by reacting 2-hydroxyethyl isocyanate with 2,4,6-triiodobenzoic acid in the presence of a base like sodium hydroxide. The reaction is conducted under careful temperature control to ensure high selectivity and yield. The product is then purified by recrystallization or column chromatography.

About

CAS No 22871-58-5
English Name 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid
Molecular Formula C10H9I3N2O4
Molecular Weight 601.9 g/mol
SMILES C(CO)NC(=O)C1=C(C(=C(C(=C1I)N)I)C(=O)O)I
InChIKey WGLWRCXOMJLZME-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid (CAS: 22871-58-5)?

3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid has a crystalline form with a molecu...

Compound Q&A

What industries use 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid (CAS: 22871-58-5)?

3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid finds applications in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid (CAS: 22871-58-5)?

When handling 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid, wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...