Compound Q&A

What are the physical and chemical properties of 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid (CAS: 22871-58-5)?

Answer

3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid
3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid has a crystalline form with a molecular weight of approximately 625.09 g/mol. It is poorly soluble in water but has good solubility in organic solvents. The compound is highly reactive due to its iodine content and amine functionalities. It is stable under normal conditions but should be handled with care to avoid decomposition under extreme pH or temperature conditions.

About

CAS No 22871-58-5
English Name 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid
Molecular Formula C10H9I3N2O4
Molecular Weight 601.9 g/mol
SMILES C(CO)NC(=O)C1=C(C(=C(C(=C1I)N)I)C(=O)O)I
InChIKey WGLWRCXOMJLZME-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:35

Related Q&A

Compound Q&A

How is 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid (CAS: 22871-58-5) typically synthesized?

3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid is typically synthesized by reacting...

Compound Q&A

What industries use 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid (CAS: 22871-58-5)?

3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid finds applications in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid (CAS: 22871-58-5)?

When handling 3-Amino-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid, wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...