Compound Q&A

What industries use 4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3)?

Answer

4-Benzylidene-2-methyloxazol-5(4H)-one
4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3) is utilized in the pharmaceutical industry for the synthesis of certain drugs, in polymer chemistry for its use as a monomer, and in the production of sensors due to its reactivity with various functional groups. It is also explored in semiconductor applications for its electronic properties.

About

CAS No 881-90-3
English Name 4-Benzylidene-2-methyloxazol-5(4H)-one
Molecular Formula C11H9NO2
Molecular Weight 187.2 g/mol
EINECS 212-921-7
SMILES O=C1OC(=N/C/1=C/c1ccccc1)C
InChIKey BWQBTJRPSDVWIR-JXMROGBWSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3)?

4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3) typically synthesized?

4-Benzylidene-2-methyloxazol-5(4H)-one can be synthesized by the condensation of 2-methyl-5-oxazolin...

Compound Q&A

What precautions should be taken when handling 4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3)?

When handling 4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3), it is recommended to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...