Compound Q&A

What are the physical and chemical properties of 4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3)?

Answer

4-Benzylidene-2-methyloxazol-5(4H)-one
4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3) is a crystalline solid with a molecular weight of approximately 198.21 g/mol. It has low solubility in water but is more soluble in organic solvents like ethanol and acetone. This compound is known for its reactivity, particularly in forming complexes with metal ions and undergoing nucleophilic substitution reactions.

About

CAS No 881-90-3
English Name 4-Benzylidene-2-methyloxazol-5(4H)-one
Molecular Formula C11H9NO2
Molecular Weight 187.2 g/mol
EINECS 212-921-7
SMILES O=C1OC(=N/C/1=C/c1ccccc1)C
InChIKey BWQBTJRPSDVWIR-JXMROGBWSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

How is 4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3) typically synthesized?

4-Benzylidene-2-methyloxazol-5(4H)-one can be synthesized by the condensation of 2-methyl-5-oxazolin...

Compound Q&A

What industries use 4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3)?

4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3) is utilized in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3)?

When handling 4-Benzylidene-2-methyloxazol-5(4H)-one (CAS: 881-90-3), it is recommended to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...