Compound Q&A

What are the main uses of 1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid (CAS: 105400-81-5)?

Answer

1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid
1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid finds applications in pharmaceuticals as a potential lead compound for drug discovery and development. It is also used in research for its unique chemical properties, such as its ability to modulate certain biological pathways. Its utility is limited to specialized applications due to its specific chemical structure and reactivity.

About

English Name 1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid
Molecular Formula C11H13NO2
Molecular Weight 191.23 g/mol
SMILES C1CNC(C2=CC=CC=C21)CC(=O)O
InChIKey BUAVPRGEIAVFBF-UHFFFAOYSA-N
Last Updated: 2026-01-09 06:33

Related Q&A

Compound Q&A

What is 1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid (CAS: 105400-81-5)?

1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid is a synthetic organic compound with a CAS number of 1...

Compound Q&A

Is 1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid (CAS: 105400-81-5) safe?

1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid is generally safe when handled with appropriate cautio...

Compound Q&A

How should 1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid (CAS: 105400-81-5) be stored?

1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid should be stored in a dry, cool, and well-ventilated a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...