Compound Q&A

What is 1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid (CAS: 105400-81-5)?

Answer

1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid
1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid is a synthetic organic compound with a CAS number of 105400-81-5. It is an acid with a unique structure featuring a tetrahydroisoquinoline ring system and an acetic acid moiety. This compound is characterized by its hydrophobic and acidic properties, making it useful in various applications such as medicinal chemistry and pharmaceutical research.

About

English Name 1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid
Molecular Formula C11H13NO2
Molecular Weight 191.23 g/mol
SMILES C1CNC(C2=CC=CC=C21)CC(=O)O
InChIKey BUAVPRGEIAVFBF-UHFFFAOYSA-N
Last Updated: 2026-01-09 06:33

Related Q&A

Compound Q&A

What are the main uses of 1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid (CAS: 105400-81-5)?

1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid finds applications in pharmaceuticals as a potential l...

Compound Q&A

Is 1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid (CAS: 105400-81-5) safe?

1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid is generally safe when handled with appropriate cautio...

Compound Q&A

How should 1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid (CAS: 105400-81-5) be stored?

1,2,3,4-Tetrahydro-1-isoquinolinylacetic acid should be stored in a dry, cool, and well-ventilated a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...