Compound Q&A

What industries use Sulfosate (CAS: 81591-81-3)?

Answer

Sulfosate
Sulfosate (CAS: 81591-81-3) is widely used in the pharmaceutical industry for the modification of drug molecules to improve their solubility and bioavailability. It also finds applications in the polymer industry, where it is used as a curing agent and in the production of functionalized polymers. Additionally, it is utilized in sensor technology for its unique reactivity and in semiconductor manufacturing for surface modification purposes.

About

CAS No 81591-81-3
English Name Sulfosate
Molecular Formula C6H16NO5PS
Molecular Weight 245.23 g/mol
SMILES C[S+](C)C.C(C(=O)O)NCP(=O)(O)[O-]
InChIKey RUCAXVJJQQJZGU-UHFFFAOYSA-M
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sulfosate (CAS: 81591-81-3)?

Sulfosate (CAS: 81591-81-3) is a crystalline solid with a molecular weight of approximately 218.15 g...

Compound Q&A

How is Sulfosate (CAS: 81591-81-3) typically synthesized?

Sulfosate (CAS: 81591-81-3) is synthesized by the reaction of a primary amine with sodium sulfate in...

Compound Q&A

What precautions should be taken when handling Sulfosate (CAS: 81591-81-3)?

When handling Sulfosate (CAS: 81591-81-3), it is crucial to use personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...