Compound Q&A

How is Sulfosate (CAS: 81591-81-3) typically synthesized?

Answer

Sulfosate
Sulfosate (CAS: 81591-81-3) is synthesized by the reaction of a primary amine with sodium sulfate in the presence of a suitable catalyst. Common methods include the use of amines like ethylenediamine with sodium sulfate, yielding a product that is highly reactive and selective for the desired sulfated amine.

About

CAS No 81591-81-3
English Name Sulfosate
Molecular Formula C6H16NO5PS
Molecular Weight 245.23 g/mol
SMILES C[S+](C)C.C(C(=O)O)NCP(=O)(O)[O-]
InChIKey RUCAXVJJQQJZGU-UHFFFAOYSA-M
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sulfosate (CAS: 81591-81-3)?

Sulfosate (CAS: 81591-81-3) is a crystalline solid with a molecular weight of approximately 218.15 g...

Compound Q&A

What industries use Sulfosate (CAS: 81591-81-3)?

Sulfosate (CAS: 81591-81-3) is widely used in the pharmaceutical industry for the modification of dr...

Compound Q&A

What precautions should be taken when handling Sulfosate (CAS: 81591-81-3)?

When handling Sulfosate (CAS: 81591-81-3), it is crucial to use personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...