Compound Q&A

What industries use Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate (CAS: 745078-03-9)?

Answer

Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate
Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate is used in the pharmaceutical industry for the synthesis of various biologically active compounds. It is also utilized in the polymer industry for the modification of polymers to enhance their properties. Additionally, it has applications in the sensor technology and semiconductor manufacturing sectors due to its unique chemical structure and reactivity.

About

English Name Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate
Molecular Formula C10H14N2O4S
Molecular Weight 258.3 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(S1)C(=O)OC
InChIKey QYBMXOPMKOCQGN-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate (CAS: 745078-03-9)?

Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate is a white crystalline solid with a mole...

Compound Q&A

How is Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate (CAS: 745078-03-9) typically synthesized?

Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate can be synthesized by reacting methyl is...

Compound Q&A

What precautions should be taken when handling Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate (CAS: 745078-03-9)?

When handling Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate, it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...