Compound Q&A

How is Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate (CAS: 745078-03-9) typically synthesized?

Answer

Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate
Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate can be synthesized by reacting methyl isothiocyanate with thiazole-5-carboxylic acid in the presence of a base. The reaction typically involves the use of pyridine as a base to facilitate the formation of the thiazole ring. High yields are achievable under mild conditions, and the product can be purified by recrystallization from ethanol.

About

English Name Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate
Molecular Formula C10H14N2O4S
Molecular Weight 258.3 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(S1)C(=O)OC
InChIKey QYBMXOPMKOCQGN-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate (CAS: 745078-03-9)?

Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate is a white crystalline solid with a mole...

Compound Q&A

What industries use Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate (CAS: 745078-03-9)?

Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate is used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate (CAS: 745078-03-9)?

When handling Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate, it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...