Compound Q&A

What precautions should be taken when handling tert-Butyl 4-((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)piperazine-1-carboxylate (CAS: 1042917-53-2)?

Answer

tert-Butyl 4-((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)piperazine-1-carboxylate
Proper personal protective equipment (PPE) such as gloves, goggles, and lab coat should be worn when handling this compound. It should be stored in a cool, dry place away from heat and direct sunlight. In case of spill, it should be cleaned up using appropriate absorbent materials. Handling should be done in a fume hood to minimize exposure. Always refer to the Safety Data Sheet (SDS) for comprehensive safety information.

About

English Name tert-Butyl 4-((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)piperazine-1-carboxylate
Molecular Formula C21H33BN2O6S
Molecular Weight 452.38 g/mol
SMILES B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)N3CCN(CC3)C(=O)OC(C)(C)C
InChIKey SYBIHBXDDYAZBX-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 4-((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)piperazine-1-carboxylate (CAS: 1042917-53-2)?

This compound is a white solid with a crystalline form. Its molecular weight is approximately 508.51...

Compound Q&A

How is tert-Butyl 4-((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)piperazine-1-carboxylate (CAS: 1042917-53-2) typically synthesized?

This compound is typically synthesized via a coupling reaction between 4-(4,4,5,5-tetramethyl-1,3,2-...

Compound Q&A

What industries use tert-Butyl 4-((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)piperazine-1-carboxylate (CAS: 1042917-53-2)?

This compound is primarily used in the pharmaceutical industry as an intermediate in the synthesis o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...