Compound Q&A

How is Acetylvardenafil (CAS: 1261351-28-3) typically synthesized?

Answer

Acetylvardenafil
Acetylvardenafil is synthesized through a multi-step reaction involving the acetylation of vardenafil. Commonly, it involves the use of acetic anhydride as the acetylating agent in the presence of a catalyst such as pyridine. The reaction is carried out under anhydrous conditions to ensure high yield and selectivity. The product is purified through recrystallization and further characterized for quality control.

About

English Name Acetylvardenafil
Molecular Formula C25H34N6O3
Molecular Weight 466.59 g/mol
SMILES CCCC1=NC(=C2N1N=C(NC2=O)C3=C(C=CC(=C3)C(=O)CN4CCN(CC4)CC)OCC)C
InChIKey XWSVFUHSNIIXMW-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of Acetylvardenafil (CAS: 1261351-28-3)?

Acetylvardenafil is a crystalline compound with a molecular weight of approximately 519.63 g/mol. It...

Compound Q&A

What industries use Acetylvardenafil (CAS: 1261351-28-3)?

Acetylvardenafil is primarily used in the pharmaceutical industry, where it is an active ingredient ...

Compound Q&A

What precautions should be taken when handling Acetylvardenafil (CAS: 1261351-28-3)?

When handling Acetylvardenafil, it is important to wear appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...