Compound Q&A

What industries use 1,1'-Binaphthalene-2,2'-dicarboxylic acid (CAS: 99827-46-0)?

Answer

1,1'-Binaphthalene-2,2'-dicarboxylic acid
1,1'-Binaphthalene-2,2'-dicarboxylic acid is used in the pharmaceutical industry for the synthesis of certain organic compounds. It also finds applications in the development of polymer materials, sensors, and semiconductor devices due to its unique electronic and structural properties.

About

CAS No 99827-46-0
English Name 1,1'-Binaphthalene-2,2'-dicarboxylic acid
Molecular Formula C22H14O4
Molecular Weight 342.35 g/mol
SMILES C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)C(=O)O)C(=O)O
InChIKey YDZNRNHKJQTGCG-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1'-Binaphthalene-2,2'-dicarboxylic acid (CAS: 99827-46-0)?

1,1'-Binaphthalene-2,2'-dicarboxylic acid is a crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 1,1'-Binaphthalene-2,2'-dicarboxylic acid (CAS: 99827-46-0) typically synthesized?

1,1'-Binaphthalene-2,2'-dicarboxylic acid is commonly synthesized via the esterification of naphthal...

Compound Q&A

What precautions should be taken when handling 1,1'-Binaphthalene-2,2'-dicarboxylic acid (CAS: 99827-46-0)?

When handling 1,1'-Binaphthalene-2,2'-dicarboxylic acid, it is recommended to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...