Compound Q&A

How is 1,1'-Binaphthalene-2,2'-dicarboxylic acid (CAS: 99827-46-0) typically synthesized?

Answer

1,1'-Binaphthalene-2,2'-dicarboxylic acid
1,1'-Binaphthalene-2,2'-dicarboxylic acid is commonly synthesized via the esterification of naphthalene-2,2'-dibromide with an appropriate carboxylic acid anhydride in the presence of a catalyst such as aluminum chloride. The reaction is typically carried out in anhydrous conditions to achieve high yields and selectivity.

About

CAS No 99827-46-0
English Name 1,1'-Binaphthalene-2,2'-dicarboxylic acid
Molecular Formula C22H14O4
Molecular Weight 342.35 g/mol
SMILES C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)C(=O)O)C(=O)O
InChIKey YDZNRNHKJQTGCG-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1'-Binaphthalene-2,2'-dicarboxylic acid (CAS: 99827-46-0)?

1,1'-Binaphthalene-2,2'-dicarboxylic acid is a crystalline solid with a molecular weight of approxim...

Compound Q&A

What industries use 1,1'-Binaphthalene-2,2'-dicarboxylic acid (CAS: 99827-46-0)?

1,1'-Binaphthalene-2,2'-dicarboxylic acid is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 1,1'-Binaphthalene-2,2'-dicarboxylic acid (CAS: 99827-46-0)?

When handling 1,1'-Binaphthalene-2,2'-dicarboxylic acid, it is recommended to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...