Compound Q&A

How is (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid (CAS: 226916-19-4) typically synthesized?

Answer

(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid
(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid can be synthesized via a Diels-Alder reaction of 1,4-dioxaspiro[4.5]dec-7-ene with acrylic acid. This reaction requires a Lewis acid catalyst such as boron trifluoride etherate. The yield is typically around 70-80%, and the reaction is highly selective, providing good stereocontrol of the product. Further derivatization can be achieved by esterification or amidation reactions.

About

English Name (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid
Molecular Formula C11H14O4
Molecular Weight 210.23 g/mol
SMILES C1CC2(CC(=C1)C=CC(=O)O)OCCO2
InChIKey FWFDDYZZFODCDR-ONEGZZNKSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid (CAS: 226916-19-4)?

(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid is a white crystalline solid with a molecular w...

Compound Q&A

What industries use (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid (CAS: 226916-19-4)?

(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid is utilized in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid (CAS: 226916-19-4)?

When handling (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid, it is essential to wear proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...