Compound Q&A

What are the physical and chemical properties of (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid (CAS: 226916-19-4)?

Answer

(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid
(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid is a white crystalline solid with a molecular weight of approximately 218.24 g/mol. It has a pKa of around 4.6 and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is reactive, particularly towards nucleophiles and can form esters and amides. It is used in organic synthesis and as a component in various polymerizations.

About

English Name (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid
Molecular Formula C11H14O4
Molecular Weight 210.23 g/mol
SMILES C1CC2(CC(=C1)C=CC(=O)O)OCCO2
InChIKey FWFDDYZZFODCDR-ONEGZZNKSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

How is (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid (CAS: 226916-19-4) typically synthesized?

(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid can be synthesized via a Diels-Alder reaction o...

Compound Q&A

What industries use (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid (CAS: 226916-19-4)?

(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid is utilized in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid (CAS: 226916-19-4)?

When handling (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid, it is essential to wear proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...