Compound Q&A

What precautions should be taken when handling N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5)?

Answer

N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)]
When handling this compound, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood. Spills should be handled using appropriate absorbent materials and disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency protocols.

About

CAS No 74974-15-5
English Name N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)]
Molecular Formula C44H34N2P2
Molecular Weight 652.7180000000002 g/mol
SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)NC3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)NP(C7=CC=CC=C7)C8=CC=CC=C8
InChIKey NRWZSRQDRSYPNW-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5)?

The compound exhibits a crystalline form with a high melting point. Its molecular weight is approxim...

Compound Q&A

How is N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5) typically synthesized?

The compound is typically synthesized via a multi-step process involving the reaction of diphenylpho...

Compound Q&A

What industries use N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5)?

This compound is primarily used in the electronics industry, particularly in the development of sens...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...