Compound Q&A

How is N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5) typically synthesized?

Answer

N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)]
The compound is typically synthesized via a multi-step process involving the reaction of diphenylphosphine with naphthalene derivatives under anhydrous conditions. The synthesis requires the use of a catalyst such as triphenylphosphine oxide. High yields and good selectivity are achieved through careful control of reaction conditions and purification steps.

About

CAS No 74974-15-5
English Name N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)]
Molecular Formula C44H34N2P2
Molecular Weight 652.7180000000002 g/mol
SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)NC3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)NP(C7=CC=CC=C7)C8=CC=CC=C8
InChIKey NRWZSRQDRSYPNW-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5)?

The compound exhibits a crystalline form with a high melting point. Its molecular weight is approxim...

Compound Q&A

What industries use N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5)?

This compound is primarily used in the electronics industry, particularly in the development of sens...

Compound Q&A

What precautions should be taken when handling N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...