Compound Q&A

What are the physical and chemical properties of N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5)?

Answer

N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)]
The compound exhibits a crystalline form with a high melting point. Its molecular weight is approximately 926.1 g/mol. It is poorly soluble in water but soluble in organic solvents like dichloromethane and chloroform. Chemically, it is stable under normal conditions but reacts with strong oxidizing agents. It has potential applications in sensors and semiconductors due to its unique electronic properties.

About

CAS No 74974-15-5
English Name N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)]
Molecular Formula C44H34N2P2
Molecular Weight 652.7180000000002 g/mol
SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)NC3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)NP(C7=CC=CC=C7)C8=CC=CC=C8
InChIKey NRWZSRQDRSYPNW-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

How is N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5) typically synthesized?

The compound is typically synthesized via a multi-step process involving the reaction of diphenylpho...

Compound Q&A

What industries use N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5)?

This compound is primarily used in the electronics industry, particularly in the development of sens...

Compound Q&A

What precautions should be taken when handling N,N'-1,1'-Binaphthalene-2,2'-diylbis[P,P-diphenyl(phosphinous amide)] (CAS: 74974-15-5)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...