Compound Q&A

What precautions should be taken when handling Hexamethoxydisilane (CAS: 5851-07-0)?

Answer

Hexamethoxydisilane
When handling hexamethoxydisilane (CAS: 5851-07-0), it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Ensure the work is conducted in a well-ventilated area or a fume hood. Spills should be handled using appropriate absorbent materials, and disposal should be done in accordance with local regulations. Refer to the safety data sheet (SDS) for detailed instructions on handling and storage.

About

CAS No 5851-07-0
English Name Hexamethoxydisilane
Molecular Formula C6H18O6Si2
Molecular Weight 242.38 g/mol
SMILES CO[Si](OC)(OC)[Si](OC)(OC)OC
InChIKey LMQGXNPPTQOGDG-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hexamethoxydisilane (CAS: 5851-07-0)?

Hexamethoxydisilane (CAS: 5851-07-0) is a colorless, viscous liquid at room temperature. It has a mo...

Compound Q&A

How is Hexamethoxydisilane (CAS: 5851-07-0) typically synthesized?

Hexamethoxydisilane is typically synthesized through the reaction of chlorosilane derivatives with m...

Compound Q&A

What industries use Hexamethoxydisilane (CAS: 5851-07-0)?

Hexamethoxydisilane (CAS: 5851-07-0) finds applications in various industries, including pharmaceuti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...