Compound Q&A

What industries use Hexamethoxydisilane (CAS: 5851-07-0)?

Answer

Hexamethoxydisilane
Hexamethoxydisilane (CAS: 5851-07-0) finds applications in various industries, including pharmaceuticals, where it is used in the synthesis of organic compounds. It is also used in the production of polymers, where it enhances properties such as adhesion and flexibility. Additionally, it is used in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 5851-07-0
English Name Hexamethoxydisilane
Molecular Formula C6H18O6Si2
Molecular Weight 242.38 g/mol
SMILES CO[Si](OC)(OC)[Si](OC)(OC)OC
InChIKey LMQGXNPPTQOGDG-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hexamethoxydisilane (CAS: 5851-07-0)?

Hexamethoxydisilane (CAS: 5851-07-0) is a colorless, viscous liquid at room temperature. It has a mo...

Compound Q&A

How is Hexamethoxydisilane (CAS: 5851-07-0) typically synthesized?

Hexamethoxydisilane is typically synthesized through the reaction of chlorosilane derivatives with m...

Compound Q&A

What precautions should be taken when handling Hexamethoxydisilane (CAS: 5851-07-0)?

When handling hexamethoxydisilane (CAS: 5851-07-0), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...