Compound Q&A

What precautions should be taken when handling 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3)?

Answer

4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid
When handling 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3), wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Store the compound in a cool, dry place, away from heat and direct sunlight. Handle in a fume hood to avoid inhalation and skin contact. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid
Molecular Formula C11H13NO5S
Molecular Weight 271.29 g/mol
SMILES CS(=O)(=O)NC1=CC=C(C=C1)C(=O)CCC(=O)O
InChIKey SJLUQBVGSCLNRB-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3)?

4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3) is a white crystalline sol...

Compound Q&A

How is 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3) typically synthesized?

4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3) is typically synthesized v...

Compound Q&A

What industries use 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3)?

4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3) is used in the pharmaceuti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...