Compound Q&A

What are the physical and chemical properties of 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3)?

Answer

4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid
4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3) is a white crystalline solid with a molecular weight of approximately 332.46 g/mol. It is slightly soluble in water and more soluble in organic solvents. The compound is reactive towards bases and can undergo hydrolysis under basic conditions. It also exhibits acidity due to the carboxylic acid group.

About

English Name 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid
Molecular Formula C11H13NO5S
Molecular Weight 271.29 g/mol
SMILES CS(=O)(=O)NC1=CC=C(C=C1)C(=O)CCC(=O)O
InChIKey SJLUQBVGSCLNRB-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

How is 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3) typically synthesized?

4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3) is typically synthesized v...

Compound Q&A

What industries use 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3)?

4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3) is used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3)?

When handling 4-{4-[(Methylsulfonyl)amino]phenyl}-4-oxobutanoic acid (CAS: 100632-57-3), wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...