Compound Q&A

Is Amikacin B (CAS: 48237-20-3) safe?

Answer

Amikacin B
Amikacin B (CAS: 48237-20-3) is generally considered safe when used as directed. However, it can cause adverse effects such as kidney toxicity and hearing loss. Proper use under a healthcare provider's supervision and adherence to recommended dosages are crucial to ensure safety.

About

CAS No 48237-20-3
English Name Amikacin B
Molecular Formula C22H44N6O12
Molecular Weight 584.62 g/mol
SMILES C1C(C(C(C(C1NC(=O)C(CCN)O)OC2C(C(C(C(O2)CO)O)N)O)O)OC3C(C(C(C(O3)CN)O)O)N)N
InChIKey YISFONZWEZUXDI-OUGKPOERSA-N
Last Updated: 2026-01-06 22:14

Related Q&A

Compound Q&A

What is Amikacin B (CAS: 48237-20-3)?

Amikacin B (CAS: 48237-20-3) is a complex antibiotic with a distinctive amide structure. It is prima...

Compound Q&A

What are the main uses of Amikacin B (CAS: 48237-20-3)?

Amikacin B (CAS: 48237-20-3) is mainly used in the treatment of infections caused by gram-negative b...

Compound Q&A

How should Amikacin B (CAS: 48237-20-3) be stored?

Amikacin B (CAS: 48237-20-3) should be stored in a cool, dry place away from direct sunlight and hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...