Compound Q&A

Is 2,4-Difluoro-3-hydroxybenzoic acid (CAS: 91659-08-4) safe?

Answer

2,4-Difluoro-3-hydroxybenzoic acid
2,4-Difluoro-3-hydroxybenzoic acid is generally safe when handled with appropriate precautions. However, it may cause skin irritation and should be used in a well-ventilated area. Protective measures include wearing gloves and eye protection. Avoid contact with eyes and skin and ensure proper ventilation.

About

CAS No 91659-08-4
English Name 2,4-Difluoro-3-hydroxybenzoic acid
Molecular Formula C7H4F2O3
Molecular Weight 174.1 g/mol
SMILES C1=CC(=C(C(=C1C(=O)O)F)O)F
InChIKey AYDXPNZXVSSJRD-UHFFFAOYSA-N
Last Updated: 2026-01-06 22:14

Related Q&A

Compound Q&A

What is 2,4-Difluoro-3-hydroxybenzoic acid (CAS: 91659-08-4)?

2,4-Difluoro-3-hydroxybenzoic acid is an organic compound with the molecular formula C7H4O4F2. It is...

Compound Q&A

What are the main uses of 2,4-Difluoro-3-hydroxybenzoic acid (CAS: 91659-08-4)?

2,4-Difluoro-3-hydroxybenzoic acid is primarily used in the synthesis of pharmaceuticals and agroche...

Compound Q&A

How should 2,4-Difluoro-3-hydroxybenzoic acid (CAS: 91659-08-4) be stored?

2,4-Difluoro-3-hydroxybenzoic acid should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...